C22H25ClN8O2 — CID 20802967
4-[2-[2-[2-(3-aminophenyl)-3-chloro-6-oxo-5-(propan-2-ylamino)pyrazin-1-yl]acetyl]hydrazinyl]benzenecarboximidamide (PubChem CID 20802967) has the molecular formula C22H25ClN8O2 and a molecular weight of 468.95 g/mol. Its IUPAC name is 4-[2-[2-[2-(3-aminophenyl)-3-chloro-6-oxo-5-(propan-2-ylamino)pyrazin-1-yl]acetyl]hydrazinyl]benzenecarboximidamide.
| Compound Name | 4-[2-[2-[2-(3-aminophenyl)-3-chloro-6-oxo-5-(propan-2-ylamino)pyrazin-1-yl]acetyl]hydrazinyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 20802967 |
| Molecular Formula | C22H25ClN8O2 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-[2-[2-[2-(3-aminophenyl)-3-chloro-6-oxo-5-(propan-2-ylamino)pyrazin-1-yl]acetyl]hydrazinyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NNC(=O)Cn2c(-c3cccc(N)c3)c(Cl)nc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C22H25ClN8O2/c1-12(2)27-21-22(33)31(18(19(23)28-21)14-4-3-5-15(24)10-14)11-17(32)30-29-16-8-6-13(7-9-16)20(25)26/h3-10,12,29H,11,24H2,1-2H3,(H3,25,26)(H,27,28)(H,30,32) |
| InChIKey | NSOYYXSKFBIRKL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|