C24H27ClN6O — CID 20802965
4-[(E)-4-[2-(3-aminophenyl)-3-chloro-6-oxo-5-(propan-2-ylamino)pyrazin-1-yl]but-2-enyl]benzenecarboximidamide (PubChem CID 20802965) has the molecular formula C24H27ClN6O and a molecular weight of 450.97 g/mol. Its IUPAC name is 4-[(E)-4-[2-(3-aminophenyl)-3-chloro-6-oxo-5-(propan-2-ylamino)pyrazin-1-yl]but-2-enyl]benzenecarboximidamide.
| Compound Name | 4-[(E)-4-[2-(3-aminophenyl)-3-chloro-6-oxo-5-(propan-2-ylamino)pyrazin-1-yl]but-2-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 20802965 |
| Molecular Formula | C24H27ClN6O |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 4-[(E)-4-[2-(3-aminophenyl)-3-chloro-6-oxo-5-(propan-2-ylamino)pyrazin-1-yl]but-2-enyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C/C=C/Cn2c(-c3cccc(N)c3)c(Cl)nc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C24H27ClN6O/c1-15(2)29-23-24(32)31(20(21(25)30-23)18-7-5-8-19(26)14-18)13-4-3-6-16-9-11-17(12-10-16)22(27)28/h3-5,7-12,14-15H,6,13,26H2,1-2H3,(H3,27,28)(H,29,30)/b4-3+ |
| InChIKey | MEMHGBHZFHZETL-ONEGZZNKSA-N |
| XLogP | 4.05 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|