C41H43ClN2O8 — CID 20839490
(Z)-but-2-enedioic acid;2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethyl 2-(3-benzoylphenyl)propanoate (PubChem CID 20839490) has the molecular formula C41H43ClN2O8 and a molecular weight of 727.25 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethyl 2-(3-benzoylphenyl)propanoate.
| Compound Name | (Z)-but-2-enedioic acid;2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethyl 2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 20839490 |
| Molecular Formula | C41H43ClN2O8 |
| Molecular Weight | 727.25 g/mol |
| Exact Mass | 726.27 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethyl 2-(3-benzoylphenyl)propanoate |
| SMILES | CC(C(=O)OCCOCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1)c1cccc(C(=O)c2ccccc2)c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C37H39ClN2O4.C4H4O4/c1-28(32-13-8-14-33(27-32)36(41)31-11-6-3-7-12-31)37(42)44-26-25-43-24-23-39-19-21-40(22-20-39)35(29-9-4-2-5-10-29)30-15-17-34(38)18-16-30;5-3(6)1-2-4(7)8/h2-18,27-28,35H,19-26H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | YHCVDJDOXFGFTH-BTJKTKAUSA-N |
| XLogP | 6.35 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.25 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|