C16H19N3O7 — CID 20864778
4-nitro-5-propan-2-yl-N-(3,4,5-trimethoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 20864778) has the molecular formula C16H19N3O7 and a molecular weight of 365.34 g/mol. Its IUPAC name is 4-nitro-5-propan-2-yl-N-(3,4,5-trimethoxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 4-nitro-5-propan-2-yl-N-(3,4,5-trimethoxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 20864778 |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-nitro-5-propan-2-yl-N-(3,4,5-trimethoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2noc(C(C)C)c2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C16H19N3O7/c1-8(2)14-13(19(21)22)12(18-26-14)16(20)17-9-6-10(23-3)15(25-5)11(7-9)24-4/h6-8H,1-5H3,(H,17,20) |
| InChIKey | VNUWAWASFQBOKY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|