C16H29NO2 — CID 20872092
3-butyl-5,6-ditert-butyl-2H-1,3-oxazin-4-one (PubChem CID 20872092) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 3-butyl-5,6-ditert-butyl-2H-1,3-oxazin-4-one.
| Compound Name | 3-butyl-5,6-ditert-butyl-2H-1,3-oxazin-4-one |
|---|---|
| PubChem CID | 20872092 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 3-butyl-5,6-ditert-butyl-2H-1,3-oxazin-4-one |
| SMILES | CCCCN1COC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H29NO2/c1-8-9-10-17-11-19-13(16(5,6)7)12(14(17)18)15(2,3)4/h8-11H2,1-7H3 |
| InChIKey | CWXACURMWVQYQC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |