C21H35O5P3 — CID 21026345
methyl (6E,8E,10E,14E,16E)-5,12,18-tris(phosphanyloxy)icosa-6,8,10,14,16-pentaenoate (PubChem CID 21026345) has the molecular formula C21H35O5P3 and a molecular weight of 460.43 g/mol. Its IUPAC name is methyl (6E,8E,10E,14E,16E)-5,12,18-tris(phosphanyloxy)icosa-6,8,10,14,16-pentaenoate.
| Compound Name | methyl (6E,8E,10E,14E,16E)-5,12,18-tris(phosphanyloxy)icosa-6,8,10,14,16-pentaenoate |
|---|---|
| PubChem CID | 21026345 |
| Molecular Formula | C21H35O5P3 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | methyl (6E,8E,10E,14E,16E)-5,12,18-tris(phosphanyloxy)icosa-6,8,10,14,16-pentaenoate |
| SMILES | CCC(/C=C/C=C/CC(/C=C/C=C/C=C/C(CCCC(=O)OC)OP)OP)OP |
| InChI | InChI=1S/C21H35O5P3/c1-3-18(24-27)12-9-6-10-15-19(25-28)13-7-4-5-8-14-20(26-29)16-11-17-21(22)23-2/h4-10,12-14,18-20H,3,11,15-17,27-29H2,1-2H3/b5-4+,10-6+,12-9+,13-7+,14-8+ |
| InChIKey | FZNKEWULDFRKPB-BFVAEYFSSA-N |
| XLogP | 5.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|