C19H19N3O4S2 — CID 21137057
4-methoxy-7-morpholin-4-yl-N-(2-oxo-2-thiophen-3-ylethyl)-1,3-benzothiazole-2-carboxamide (PubChem CID 21137057) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-methoxy-7-morpholin-4-yl-N-(2-oxo-2-thiophen-3-ylethyl)-1,3-benzothiazole-2-carboxamide.
| Compound Name | 4-methoxy-7-morpholin-4-yl-N-(2-oxo-2-thiophen-3-ylethyl)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 21137057 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 4-methoxy-7-morpholin-4-yl-N-(2-oxo-2-thiophen-3-ylethyl)-1,3-benzothiazole-2-carboxamide |
| SMILES | COc1ccc(N2CCOCC2)c2sc(C(=O)NCC(=O)c3ccsc3)nc12 |
| InChI | InChI=1S/C19H19N3O4S2/c1-25-15-3-2-13(22-5-7-26-8-6-22)17-16(15)21-19(28-17)18(24)20-10-14(23)12-4-9-27-11-12/h2-4,9,11H,5-8,10H2,1H3,(H,20,24) |
| InChIKey | NNMNZPDEPNKPIX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|