C17H20N6O2 — CID 21145608
[(2S,5R)-5-(6-aminopurin-9-yl)-4-(benzylamino)oxolan-2-yl]methanol (PubChem CID 21145608) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is [(2S,5R)-5-(6-aminopurin-9-yl)-4-(benzylamino)oxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(6-aminopurin-9-yl)-4-(benzylamino)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 21145608 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [(2S,5R)-5-(6-aminopurin-9-yl)-4-(benzylamino)oxolan-2-yl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)CC1NCc1ccccc1 |
| InChI | InChI=1S/C17H20N6O2/c18-15-14-16(21-9-20-15)23(10-22-14)17-13(6-12(8-24)25-17)19-7-11-4-2-1-3-5-11/h1-5,9-10,12-13,17,19,24H,6-8H2,(H2,18,20,21)/t12-,13?,17+/m0/s1 |
| InChIKey | WREDAANYCRGDHQ-GFMNRZNCSA-N |
| XLogP | 0.85 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |