C26H33N3O — CID 21176365
N-[(E)-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]pyridine-3-carboxamide (PubChem CID 21176365) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is N-[(E)-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 21176365 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | N-[(E)-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]pyridine-3-carboxamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=N/NC(=O)c2cccnc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H33N3O/c1-20(13-14-24-22(3)11-7-16-26(24,4)5)9-6-10-21(2)15-18-28-29-25(30)23-12-8-17-27-19-23/h6,8-10,12-15,17-19H,7,11,16H2,1-5H3,(H,29,30)/b10-6+,14-13+,20-9+,21-15+,28-18+ |
| InChIKey | RZZQUTADLRVOLI-VEPARLILSA-N |
| XLogP | 6.33 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|