C20H14F2N4O2 — CID 21198154
7-amino-3-benzyl-1-(3,5-difluorophenyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 21198154) has the molecular formula C20H14F2N4O2 and a molecular weight of 380.35 g/mol. Its IUPAC name is 7-amino-3-benzyl-1-(3,5-difluorophenyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-amino-3-benzyl-1-(3,5-difluorophenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21198154 |
| Molecular Formula | C20H14F2N4O2 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 7-amino-3-benzyl-1-(3,5-difluorophenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Nc1ccc2c(=O)n(Cc3ccccc3)c(=O)n(-c3cc(F)cc(F)c3)c2n1 |
| InChI | InChI=1S/C20H14F2N4O2/c21-13-8-14(22)10-15(9-13)26-18-16(6-7-17(23)24-18)19(27)25(20(26)28)11-12-4-2-1-3-5-12/h1-10H,11H2,(H2,23,24) |
| InChIKey | NQBQWHQHVMOEIY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |