C20H26N6O2S — CID 21220751
1-[2-[[14-[2-(2-hydroxyethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethylamino]ethanol (PubChem CID 21220751) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is 1-[2-[[14-[2-(2-hydroxyethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethylamino]ethanol.
| Compound Name | 1-[2-[[14-[2-(2-hydroxyethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 21220751 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[2-[[14-[2-(2-hydroxyethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethylamino]ethanol |
| SMILES | CC(O)NCCNc1ccc2c3c(nn2CCNCCO)-c2ncccc2Sc13 |
| InChI | InChI=1S/C20H26N6O2S/c1-13(28)22-7-8-23-14-4-5-15-17-19(25-26(15)11-9-21-10-12-27)18-16(29-20(14)17)3-2-6-24-18/h2-6,13,21-23,27-28H,7-12H2,1H3 |
| InChIKey | APXKDLPPAHIKJS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|