C20H26N6OS — CID 54247825
2-[2-[[14-[2-(dimethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethylamino]ethanol (PubChem CID 54247825) has the molecular formula C20H26N6OS and a molecular weight of 398.54 g/mol. Its IUPAC name is 2-[2-[[14-[2-(dimethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethylamino]ethanol.
| Compound Name | 2-[2-[[14-[2-(dimethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 54247825 |
| Molecular Formula | C20H26N6OS |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-[2-[[14-[2-(dimethylamino)ethyl]-8-thia-3,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethylamino]ethanol |
| SMILES | CN(C)CCn1nc2c3c(c(NCCNCCO)ccc31)Sc1cccnc1-2 |
| InChI | InChI=1S/C20H26N6OS/c1-25(2)11-12-26-15-6-5-14(22-9-8-21-10-13-27)20-17(15)19(24-26)18-16(28-20)4-3-7-23-18/h3-7,21-22,27H,8-13H2,1-2H3 |
| InChIKey | QUNZAQQOYFPNLV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|