C21H17NO5 — CID 21235323
2-[methyl-(2-oxo-8-prop-2-enylchromene-3-carbonyl)amino]benzoic acid (PubChem CID 21235323) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-[methyl-(2-oxo-8-prop-2-enylchromene-3-carbonyl)amino]benzoic acid.
| Compound Name | 2-[methyl-(2-oxo-8-prop-2-enylchromene-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 21235323 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[methyl-(2-oxo-8-prop-2-enylchromene-3-carbonyl)amino]benzoic acid |
| SMILES | C=CCc1cccc2cc(C(=O)N(C)c3ccccc3C(=O)O)c(=O)oc12 |
| InChI | InChI=1S/C21H17NO5/c1-3-7-13-8-6-9-14-12-16(21(26)27-18(13)14)19(23)22(2)17-11-5-4-10-15(17)20(24)25/h3-6,8-12H,1,7H2,2H3,(H,24,25) |
| InChIKey | GWCDOLFWZJSWNQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|