C22H22N3O3+ — CID 6969016
8-prop-2-enyl-3-(4-pyridin-1-ium-2-ylpiperazine-1-carbonyl)chromen-2-one (PubChem CID 6969016) has the molecular formula C22H22N3O3+ and a molecular weight of 376.44 g/mol. Its IUPAC name is 8-prop-2-enyl-3-(4-pyridin-1-ium-2-ylpiperazine-1-carbonyl)chromen-2-one.
| Compound Name | 8-prop-2-enyl-3-(4-pyridin-1-ium-2-ylpiperazine-1-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 6969016 |
| Molecular Formula | C22H22N3O3+ |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 8-prop-2-enyl-3-(4-pyridin-1-ium-2-ylpiperazine-1-carbonyl)chromen-2-one |
| SMILES | C=CCc1cccc2cc(C(=O)N3CCN(c4cccc[nH+]4)CC3)c(=O)oc12 |
| InChI | InChI=1S/C22H21N3O3/c1-2-6-16-7-5-8-17-15-18(22(27)28-20(16)17)21(26)25-13-11-24(12-14-25)19-9-3-4-10-23-19/h2-5,7-10,15H,1,6,11-14H2/p+1 |
| InChIKey | UIVRJPVTBWVQPA-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|