C18H37N2O2P — CID 21277974
N-butyl-N-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 21277974) has the molecular formula C18H37N2O2P and a molecular weight of 344.48 g/mol. Its IUPAC name is N-butyl-N-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-butyl-N-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 21277974 |
| Molecular Formula | C18H37N2O2P |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | N-butyl-N-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CCCCN(C1CC(C)(C)NC(C)(C)C1)P1OCC(C)(C)CO1 |
| InChI | InChI=1S/C18H37N2O2P/c1-8-9-10-20(23-21-13-16(2,3)14-22-23)15-11-17(4,5)19-18(6,7)12-15/h15,19H,8-14H2,1-7H3 |
| InChIKey | YGSWHLCTTDZHHG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|