C19H39N2O2P — CID 21277936
N-butyl-N-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-1,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 21277936) has the molecular formula C19H39N2O2P and a molecular weight of 358.51 g/mol. Its IUPAC name is N-butyl-N-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-1,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | N-butyl-N-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-1,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 21277936 |
| Molecular Formula | C19H39N2O2P |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | N-butyl-N-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-1,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | CCCCN(C1CC(C)(C)N(C)C(C)(C)C1)P1OCC(C)(C)CO1 |
| InChI | InChI=1S/C19H39N2O2P/c1-9-10-11-21(24-22-14-17(2,3)15-23-24)16-12-18(4,5)20(8)19(6,7)13-16/h16H,9-15H2,1-8H3 |
| InChIKey | YKYXCKWAYFHNTQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|