C40H80N4O4P2 — CID 21277959
N,N'-bis(5,5-dimethyl-4-propan-2-yl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 21277959) has the molecular formula C40H80N4O4P2 and a molecular weight of 743.05 g/mol. Its IUPAC name is N,N'-bis(5,5-dimethyl-4-propan-2-yl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(5,5-dimethyl-4-propan-2-yl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 21277959 |
| Molecular Formula | C40H80N4O4P2 |
| Molecular Weight | 743.05 g/mol |
| Exact Mass | 742.57 |
| IUPAC Name | N,N'-bis(5,5-dimethyl-4-propan-2-yl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CC(C)C1OP(N(CCCCCCN(C2CC(C)(C)NC(C)(C)C2)P2OCC(C)(C)C(C(C)C)O2)C2CC(C)(C)NC(C)(C)C2)OCC1(C)C |
| InChI | InChI=1S/C40H80N4O4P2/c1-29(2)33-35(5,6)27-45-49(47-33)43(31-23-37(9,10)41-38(11,12)24-31)21-19-17-18-20-22-44(32-25-39(13,14)42-40(15,16)26-32)50-46-28-36(7,8)34(48-50)30(3)4/h29-34,41-42H,17-28H2,1-16H3 |
| InChIKey | GUZDOUORSHLHQZ-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.05 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|