C22H32N2O7 — CID 21296377
(E)-but-2-enedioic acid;2-(9-ethoxy-2,3,4a,5,6,11b-hexahydro-[1]benzoxepino[5,4-b][1,4]oxazin-4-yl)-N,N-dimethylethanamine (PubChem CID 21296377) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(9-ethoxy-2,3,4a,5,6,11b-hexahydro-[1]benzoxepino[5,4-b][1,4]oxazin-4-yl)-N,N-dimethylethanamine.
| Compound Name | (E)-but-2-enedioic acid;2-(9-ethoxy-2,3,4a,5,6,11b-hexahydro-[1]benzoxepino[5,4-b][1,4]oxazin-4-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 21296377 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(9-ethoxy-2,3,4a,5,6,11b-hexahydro-[1]benzoxepino[5,4-b][1,4]oxazin-4-yl)-N,N-dimethylethanamine |
| SMILES | CCOc1ccc2c(c1)OCCC1C2OCCN1CCN(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H28N2O3.C4H4O4/c1-4-21-14-5-6-15-17(13-14)22-11-7-16-18(15)23-12-10-20(16)9-8-19(2)3;5-3(6)1-2-4(7)8/h5-6,13,16,18H,4,7-12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BZQHYAVEDCNRFC-WLHGVMLRSA-N |
| XLogP | 1.88 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|