C20H32N4O6 — CID 21299694
tert-butyl 2-[[6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-1-(methylamino)-1-oxohexan-2-yl]amino]acetate (PubChem CID 21299694) has the molecular formula C20H32N4O6 and a molecular weight of 424.50 g/mol. Its IUPAC name is tert-butyl 2-[[6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-1-(methylamino)-1-oxohexan-2-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-1-(methylamino)-1-oxohexan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 21299694 |
| Molecular Formula | C20H32N4O6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | tert-butyl 2-[[6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-1-(methylamino)-1-oxohexan-2-yl]amino]acetate |
| SMILES | CNC(=O)C(CCCCNC(=O)CCN1C(=O)C=CC1=O)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N4O6/c1-20(2,3)30-18(28)13-23-14(19(29)21-4)7-5-6-11-22-15(25)10-12-24-16(26)8-9-17(24)27/h8-9,14,23H,5-7,10-13H2,1-4H3,(H,21,29)(H,22,25) |
| InChIKey | LMPVRSZMBYZQQJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|