C15H9F6N3O3 — CID 21325121
3,5-difluoro-N-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]pyridine-4-carboxamide (PubChem CID 21325121) has the molecular formula C15H9F6N3O3 and a molecular weight of 393.24 g/mol. Its IUPAC name is 3,5-difluoro-N-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]pyridine-4-carboxamide.
| Compound Name | 3,5-difluoro-N-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 21325121 |
| Molecular Formula | C15H9F6N3O3 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 3,5-difluoro-N-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoyl]pyridine-4-carboxamide |
| SMILES | O=C(NC(=O)c1c(F)cncc1F)Nc1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C15H9F6N3O3/c16-9-5-22-6-10(17)11(9)12(25)24-14(26)23-7-1-3-8(4-2-7)27-15(20,21)13(18)19/h1-6,13H,(H2,23,24,25,26) |
| InChIKey | HVLVPDYFRPUTHN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|