C12H13Cl3O — CID 21327856
1,2-dichloro-4-(2-chloro-3-prop-2-enoxypropyl)benzene (PubChem CID 21327856) has the molecular formula C12H13Cl3O and a molecular weight of 279.59 g/mol. Its IUPAC name is 1,2-dichloro-4-(2-chloro-3-prop-2-enoxypropyl)benzene.
| Compound Name | 1,2-dichloro-4-(2-chloro-3-prop-2-enoxypropyl)benzene |
|---|---|
| PubChem CID | 21327856 |
| Molecular Formula | C12H13Cl3O |
| Molecular Weight | 279.59 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1,2-dichloro-4-(2-chloro-3-prop-2-enoxypropyl)benzene |
| SMILES | C=CCOCC(Cl)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl3O/c1-2-5-16-8-10(13)6-9-3-4-11(14)12(15)7-9/h2-4,7,10H,1,5-6,8H2 |
| InChIKey | GLMSTNAPINGQFY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|