C31H28FN3O2S2 — CID 2132872
5-(3,4-dimethylphenyl)-2-[2-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 2132872) has the molecular formula C31H28FN3O2S2 and a molecular weight of 557.72 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-2-[2-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3,4-dimethylphenyl)-2-[2-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2132872 |
| Molecular Formula | C31H28FN3O2S2 |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-2-[2-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)n(-c3ccccc3F)c2C)nc2scc(-c3ccc(C)c(C)c3)c2c1=O |
| InChI | InChI=1S/C31H28FN3O2S2/c1-6-13-34-30(37)28-24(22-12-11-18(2)19(3)14-22)16-38-29(28)33-31(34)39-17-27(36)23-15-20(4)35(21(23)5)26-10-8-7-9-25(26)32/h6-12,14-16H,1,13,17H2,2-5H3 |
| InChIKey | DSAHORBKFCAJSB-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|