C35H41ClN6O5S — CID 21340184
(2,4,6-trimethylcyclohexyl) 5-chloro-2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-morpholin-4-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 21340184) has the molecular formula C35H41ClN6O5S and a molecular weight of 693.27 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-chloro-2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-morpholin-4-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-chloro-2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-morpholin-4-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 21340184 |
| Molecular Formula | C35H41ClN6O5S |
| Molecular Weight | 693.27 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-chloro-2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-morpholin-4-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3ccc(N4CCOCC4)c(NS(=O)Oc4cc(C)ccc4CC)c3)[nH]n2c1Cl |
| InChI | InChI=1S/C35H41ClN6O5S/c1-7-24-9-8-20(2)18-28(24)47-48(44)40-26-19-25(10-11-27(26)41-12-14-45-15-13-41)33-38-34-29(30(37-6)32(36)42(34)39-33)35(43)46-31-22(4)16-21(3)17-23(31)5/h8-11,18-19,21-23,31,40H,7,12-17H2,1-5H3,(H,38,39) |
| InChIKey | BUWNKJVNNLTDFZ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.27 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|