C31H32N4O4 — CID 21356476
(1S,2S,4R,5R)-2-(2,4-diaminopyrimidin-5-yl)-6,6-dimethyl-4-(trityloxymethyl)-3-oxabicyclo[3.1.0]hexane-1,5-diol (PubChem CID 21356476) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is (1S,2S,4R,5R)-2-(2,4-diaminopyrimidin-5-yl)-6,6-dimethyl-4-(trityloxymethyl)-3-oxabicyclo[3.1.0]hexane-1,5-diol.
| Compound Name | (1S,2S,4R,5R)-2-(2,4-diaminopyrimidin-5-yl)-6,6-dimethyl-4-(trityloxymethyl)-3-oxabicyclo[3.1.0]hexane-1,5-diol |
|---|---|
| PubChem CID | 21356476 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | (1S,2S,4R,5R)-2-(2,4-diaminopyrimidin-5-yl)-6,6-dimethyl-4-(trityloxymethyl)-3-oxabicyclo[3.1.0]hexane-1,5-diol |
| SMILES | CC1(C)[C@]2(O)[C@H](c3cnc(N)nc3N)O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@]12O |
| InChI | InChI=1S/C31H32N4O4/c1-28(2)30(36)24(39-25(31(28,30)37)23-18-34-27(33)35-26(23)32)19-38-29(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-18,24-25,36-37H,19H2,1-2H3,(H4,32,33,34,35)/t24-,25+,30+,31-/m1/s1 |
| InChIKey | LSKNWUZNTHODKR-SUZKKURUSA-N |
| XLogP | 3.59 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|