C28H34N2O7 — CID 21363745
8-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-N-(2-phenylmethoxyethyl)-1-azabicyclo[4.2.0]octane-2-carboxamide (PubChem CID 21363745) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is 8-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-N-(2-phenylmethoxyethyl)-1-azabicyclo[4.2.0]octane-2-carboxamide.
| Compound Name | 8-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-N-(2-phenylmethoxyethyl)-1-azabicyclo[4.2.0]octane-2-carboxamide |
|---|---|
| PubChem CID | 21363745 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 8-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-N-(2-phenylmethoxyethyl)-1-azabicyclo[4.2.0]octane-2-carboxamide |
| SMILES | COc1cc(C(=O)C(=O)C2CC3CCCC(C(=O)NCCOCc4ccccc4)N32)cc(OC)c1OC |
| InChI | InChI=1S/C28H34N2O7/c1-34-23-14-19(15-24(35-2)27(23)36-3)25(31)26(32)22-16-20-10-7-11-21(30(20)22)28(33)29-12-13-37-17-18-8-5-4-6-9-18/h4-6,8-9,14-15,20-22H,7,10-13,16-17H2,1-3H3,(H,29,33) |
| InChIKey | STVJKWRYBGSQLY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|