C24H21BrF3N3O3 — CID 21374199
2-[5-bromo-3-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]indol-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 21374199) has the molecular formula C24H21BrF3N3O3 and a molecular weight of 536.35 g/mol. Its IUPAC name is 2-[5-bromo-3-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]indol-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[5-bromo-3-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]indol-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 21374199 |
| Molecular Formula | C24H21BrF3N3O3 |
| Molecular Weight | 536.35 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 2-[5-bromo-3-[(E)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]indol-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)Cn1cc(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)c2cc(Br)ccc21 |
| InChI | InChI=1S/C24H21BrF3N3O3/c1-34-8-2-7-29-22(32)13-31-12-14(18-11-16(25)4-6-21(18)31)9-19-17-5-3-15(24(26,27)28)10-20(17)30-23(19)33/h3-6,9-12H,2,7-8,13H2,1H3,(H,29,32)(H,30,33)/b19-9+ |
| InChIKey | QTDSFFHUESRTGE-DJKKODMXSA-N |
| XLogP | 5.07 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|