C23H27NO4 — CID 21392066
15-butyl-1-ethyl-8-methyl-15-azatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaene;oxalic acid (PubChem CID 21392066) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 15-butyl-1-ethyl-8-methyl-15-azatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaene;oxalic acid.
| Compound Name | 15-butyl-1-ethyl-8-methyl-15-azatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaene;oxalic acid |
|---|---|
| PubChem CID | 21392066 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 15-butyl-1-ethyl-8-methyl-15-azatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaene;oxalic acid |
| SMILES | CCCCN1C2(C)c3ccccc3C1(CC)c1ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H25N.C2H2O4/c1-4-6-15-22-20(3)16-11-7-9-13-18(16)21(22,5-2)19-14-10-8-12-17(19)20;3-1(4)2(5)6/h7-14H,4-6,15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | WPQSDLWZDCGZBQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|