C13H23IN2O4S2 — CID 21416565
butyl-methyl-[2-[(2E)-2-nitro-2-(1,3-thiazinan-2-ylidene)acetyl]oxyethyl]sulfanium iodide (PubChem CID 21416565) has the molecular formula C13H23IN2O4S2 and a molecular weight of 462.38 g/mol. Its IUPAC name is butyl-methyl-[2-[(2E)-2-nitro-2-(1,3-thiazinan-2-ylidene)acetyl]oxyethyl]sulfanium iodide.
| Compound Name | butyl-methyl-[2-[(2E)-2-nitro-2-(1,3-thiazinan-2-ylidene)acetyl]oxyethyl]sulfanium iodide |
|---|---|
| PubChem CID | 21416565 |
| Molecular Formula | C13H23IN2O4S2 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | butyl-methyl-[2-[(2E)-2-nitro-2-(1,3-thiazinan-2-ylidene)acetyl]oxyethyl]sulfanium iodide |
| SMILES | CCCC[S+](C)CCOC(=O)/C(=C1/NCCCS1)[N+](=O)[O-].[I-] |
| InChI | InChI=1S/C13H22N2O4S2.HI/c1-3-4-9-21(2)10-7-19-13(16)11(15(17)18)12-14-6-5-8-20-12;/h3-10H2,1-2H3;1H |
| InChIKey | KUCCJIUGDZZSPX-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|