C15H15N3OS — CID 21431079
N-(3-aminophenyl)acetamide;1,3-benzothiazole (PubChem CID 21431079) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(3-aminophenyl)acetamide;1,3-benzothiazole.
| Compound Name | N-(3-aminophenyl)acetamide;1,3-benzothiazole |
|---|---|
| PubChem CID | 21431079 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(3-aminophenyl)acetamide;1,3-benzothiazole |
| SMILES | CC(=O)Nc1cccc(N)c1.c1ccc2scnc2c1 |
| InChI | InChI=1S/C8H10N2O.C7H5NS/c1-6(11)10-8-4-2-3-7(9)5-8;1-2-4-7-6(3-1)8-5-9-7/h2-5H,9H2,1H3,(H,10,11);1-5H |
| InChIKey | JTYJJBZHSZYBPU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|