C18H28BN5O3 — CID 21464914
[5-amino-1-[[2-[3-(3-phenylpropyl)-1,2,4-triazol-1-yl]acetyl]amino]pentyl]boronic acid (PubChem CID 21464914) has the molecular formula C18H28BN5O3 and a molecular weight of 373.27 g/mol. Its IUPAC name is [5-amino-1-[[2-[3-(3-phenylpropyl)-1,2,4-triazol-1-yl]acetyl]amino]pentyl]boronic acid.
| Compound Name | [5-amino-1-[[2-[3-(3-phenylpropyl)-1,2,4-triazol-1-yl]acetyl]amino]pentyl]boronic acid |
|---|---|
| PubChem CID | 21464914 |
| Molecular Formula | C18H28BN5O3 |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | [5-amino-1-[[2-[3-(3-phenylpropyl)-1,2,4-triazol-1-yl]acetyl]amino]pentyl]boronic acid |
| SMILES | NCCCCC(NC(=O)Cn1cnc(CCCc2ccccc2)n1)B(O)O |
| InChI | InChI=1S/C18H28BN5O3/c20-12-5-4-10-16(19(26)27)22-18(25)13-24-14-21-17(23-24)11-6-9-15-7-2-1-3-8-15/h1-3,7-8,14,16,26-27H,4-6,9-13,20H2,(H,22,25) |
| InChIKey | TUPMDARVFRYUFT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|