C22H29BClN5O3 — CID 70249496
[5-amino-1-[[2-(5-benzyl-3-phenyl-1,2,4-triazol-1-yl)acetyl]amino]pentyl]boronic acid;hydrochloride (PubChem CID 70249496) has the molecular formula C22H29BClN5O3 and a molecular weight of 457.77 g/mol. Its IUPAC name is [5-amino-1-[[2-(5-benzyl-3-phenyl-1,2,4-triazol-1-yl)acetyl]amino]pentyl]boronic acid;hydrochloride.
| Compound Name | [5-amino-1-[[2-(5-benzyl-3-phenyl-1,2,4-triazol-1-yl)acetyl]amino]pentyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 70249496 |
| Molecular Formula | C22H29BClN5O3 |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [5-amino-1-[[2-(5-benzyl-3-phenyl-1,2,4-triazol-1-yl)acetyl]amino]pentyl]boronic acid;hydrochloride |
| SMILES | Cl.NCCCCC(NC(=O)Cn1nc(-c2ccccc2)nc1Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C22H28BN5O3.ClH/c24-14-8-7-13-19(23(30)31)25-21(29)16-28-20(15-17-9-3-1-4-10-17)26-22(27-28)18-11-5-2-6-12-18;/h1-6,9-12,19,30-31H,7-8,13-16,24H2,(H,25,29);1H |
| InChIKey | GCWHBBVIRLWYQT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|