C23H31BClN5O3 — CID 70251850
[5-amino-1-[[2-(1,5-dibenzyl-1,2,4-triazol-3-yl)acetyl]amino]pentyl]boronic acid;hydrochloride (PubChem CID 70251850) has the molecular formula C23H31BClN5O3 and a molecular weight of 471.80 g/mol. Its IUPAC name is [5-amino-1-[[2-(1,5-dibenzyl-1,2,4-triazol-3-yl)acetyl]amino]pentyl]boronic acid;hydrochloride.
| Compound Name | [5-amino-1-[[2-(1,5-dibenzyl-1,2,4-triazol-3-yl)acetyl]amino]pentyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 70251850 |
| Molecular Formula | C23H31BClN5O3 |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [5-amino-1-[[2-(1,5-dibenzyl-1,2,4-triazol-3-yl)acetyl]amino]pentyl]boronic acid;hydrochloride |
| SMILES | Cl.NCCCCC(NC(=O)Cc1nc(Cc2ccccc2)n(Cc2ccccc2)n1)B(O)O |
| InChI | InChI=1S/C23H30BN5O3.ClH/c25-14-8-7-13-20(24(31)32)26-23(30)16-21-27-22(15-18-9-3-1-4-10-18)29(28-21)17-19-11-5-2-6-12-19;/h1-6,9-12,20,31-32H,7-8,13-17,25H2,(H,26,30);1H |
| InChIKey | LQEFKMYZTZSLOQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|