C16H24BN5O3 — CID 21464933
[5-amino-1-[[2-(5-benzyl-1,2,4-triazol-1-yl)acetyl]amino]pentyl]boronic acid (PubChem CID 21464933) has the molecular formula C16H24BN5O3 and a molecular weight of 345.21 g/mol. Its IUPAC name is [5-amino-1-[[2-(5-benzyl-1,2,4-triazol-1-yl)acetyl]amino]pentyl]boronic acid.
| Compound Name | [5-amino-1-[[2-(5-benzyl-1,2,4-triazol-1-yl)acetyl]amino]pentyl]boronic acid |
|---|---|
| PubChem CID | 21464933 |
| Molecular Formula | C16H24BN5O3 |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | [5-amino-1-[[2-(5-benzyl-1,2,4-triazol-1-yl)acetyl]amino]pentyl]boronic acid |
| SMILES | NCCCCC(NC(=O)Cn1ncnc1Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C16H24BN5O3/c18-9-5-4-8-14(17(24)25)21-16(23)11-22-15(19-12-20-22)10-13-6-2-1-3-7-13/h1-3,6-7,12,14,24-25H,4-5,8-11,18H2,(H,21,23) |
| InChIKey | ZKGFTGRTPDOWOP-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|