C11H7N3O2 — CID 21498231
12,14-dioxa-3,4,6-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,4,7,9,11(15)-hexaene (PubChem CID 21498231) has the molecular formula C11H7N3O2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 12,14-dioxa-3,4,6-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,4,7,9,11(15)-hexaene.
| Compound Name | 12,14-dioxa-3,4,6-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,4,7,9,11(15)-hexaene |
|---|---|
| PubChem CID | 21498231 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 12,14-dioxa-3,4,6-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2,4,7,9,11(15)-hexaene |
| SMILES | c1cn2cnnc2c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C11H7N3O2/c1-2-14-5-12-13-11(14)8-4-10-9(3-7(1)8)15-6-16-10/h1-5H,6H2 |
| InChIKey | BPIMXMQOCTWWRI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |