C16H23Br2NO2 — CID 22006831
5-[4-(3,3-dibromoprop-2-enoxy)-2,6-dimethylphenoxy]pentan-1-amine (PubChem CID 22006831) has the molecular formula C16H23Br2NO2 and a molecular weight of 421.17 g/mol. Its IUPAC name is 5-[4-(3,3-dibromoprop-2-enoxy)-2,6-dimethylphenoxy]pentan-1-amine.
| Compound Name | 5-[4-(3,3-dibromoprop-2-enoxy)-2,6-dimethylphenoxy]pentan-1-amine |
|---|---|
| PubChem CID | 22006831 |
| Molecular Formula | C16H23Br2NO2 |
| Molecular Weight | 421.17 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 5-[4-(3,3-dibromoprop-2-enoxy)-2,6-dimethylphenoxy]pentan-1-amine |
| SMILES | Cc1cc(OCC=C(Br)Br)cc(C)c1OCCCCCN |
| InChI | InChI=1S/C16H23Br2NO2/c1-12-10-14(20-9-6-15(17)18)11-13(2)16(12)21-8-5-3-4-7-19/h6,10-11H,3-5,7-9,19H2,1-2H3 |
| InChIKey | MGIHMKYASOOECC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|