C36H47F5O9S — CID 22033325
2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-2-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butyl]propanedioic acid (PubChem CID 22033325) has the molecular formula C36H47F5O9S and a molecular weight of 750.82 g/mol. Its IUPAC name is 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-2-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butyl]propanedioic acid.
| Compound Name | 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-2-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butyl]propanedioic acid |
|---|---|
| PubChem CID | 22033325 |
| Molecular Formula | C36H47F5O9S |
| Molecular Weight | 750.82 g/mol |
| Exact Mass | 750.29 |
| IUPAC Name | 2-[4-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]butyl]-2-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butyl]propanedioic acid |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCC(CCCCSCCCC(F)(F)C(F)(F)F)(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C36H47F5O9S/c1-33(25-10-12-26(13-11-25)49-23-46-2)22-48-30-21-27(50-24-47-3)14-15-28(30)29(33)9-4-5-16-34(31(42)43,32(44)45)17-6-7-19-51-20-8-18-35(37,38)36(39,40)41/h10-15,21,29H,4-9,16-20,22-24H2,1-3H3,(H,42,43)(H,44,45) |
| InChIKey | KXWYVALJAFHLKB-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.82 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|