C26H29NO2 — CID 22045169
(4-cyanophenyl) 7-butyl-1,2,3,4,5,6,7,8-octahydrophenanthrene-2-carboxylate (PubChem CID 22045169) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (4-cyanophenyl) 7-butyl-1,2,3,4,5,6,7,8-octahydrophenanthrene-2-carboxylate.
| Compound Name | (4-cyanophenyl) 7-butyl-1,2,3,4,5,6,7,8-octahydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 22045169 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (4-cyanophenyl) 7-butyl-1,2,3,4,5,6,7,8-octahydrophenanthrene-2-carboxylate |
| SMILES | CCCCC1CCc2c(ccc3c2CCC(C(=O)Oc2ccc(C#N)cc2)C3)C1 |
| InChI | InChI=1S/C26H29NO2/c1-2-3-4-18-7-13-24-20(15-18)8-9-21-16-22(10-14-25(21)24)26(28)29-23-11-5-19(17-27)6-12-23/h5-6,8-9,11-12,18,22H,2-4,7,10,13-16H2,1H3 |
| InChIKey | SEBSFMPAVKYXSA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|