C24H24N4O2S — CID 2207028
1-[(1-benzyl-2,3-dimethylindole-5-carbonyl)amino]-3-(furan-2-ylmethyl)thiourea (PubChem CID 2207028) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-[(1-benzyl-2,3-dimethylindole-5-carbonyl)amino]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[(1-benzyl-2,3-dimethylindole-5-carbonyl)amino]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2207028 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-[(1-benzyl-2,3-dimethylindole-5-carbonyl)amino]-3-(furan-2-ylmethyl)thiourea |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)NNC(=S)NCc3ccco3)cc12 |
| InChI | InChI=1S/C24H24N4O2S/c1-16-17(2)28(15-18-7-4-3-5-8-18)22-11-10-19(13-21(16)22)23(29)26-27-24(31)25-14-20-9-6-12-30-20/h3-13H,14-15H2,1-2H3,(H,26,29)(H2,25,27,31) |
| InChIKey | ZAHKNVNXDVKCJR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|