C23H30F8O2 — CID 22080381
1,3-difluoro-6-(1,1,2,3,3,3-hexafluoropropoxy)-3-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]cyclohexa-1,4-diene (PubChem CID 22080381) has the molecular formula C23H30F8O2 and a molecular weight of 490.48 g/mol. Its IUPAC name is 1,3-difluoro-6-(1,1,2,3,3,3-hexafluoropropoxy)-3-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]cyclohexa-1,4-diene.
| Compound Name | 1,3-difluoro-6-(1,1,2,3,3,3-hexafluoropropoxy)-3-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 22080381 |
| Molecular Formula | C23H30F8O2 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 1,3-difluoro-6-(1,1,2,3,3,3-hexafluoropropoxy)-3-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]cyclohexa-1,4-diene |
| SMILES | COCC1CCC(C2CCC(C3(F)C=CC(OC(F)(F)C(F)C(F)(F)F)C(F)=C3)CC2)CC1 |
| InChI | InChI=1S/C23H30F8O2/c1-32-13-14-2-4-15(5-3-14)16-6-8-17(9-7-16)21(26)11-10-19(18(24)12-21)33-23(30,31)20(25)22(27,28)29/h10-12,14-17,19-20H,2-9,13H2,1H3 |
| InChIKey | DPKXHUFJOSFEHR-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|