C23H20ClN5 — CID 22095509
2-(4-chlorophenyl)-N-[4-(diethylamino)-2-methylphenyl]-3,3-diisocyanoprop-2-enimidoyl isocyanide (PubChem CID 22095509) has the molecular formula C23H20ClN5 and a molecular weight of 401.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-(diethylamino)-2-methylphenyl]-3,3-diisocyanoprop-2-enimidoyl isocyanide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-(diethylamino)-2-methylphenyl]-3,3-diisocyanoprop-2-enimidoyl isocyanide |
|---|---|
| PubChem CID | 22095509 |
| Molecular Formula | C23H20ClN5 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-(diethylamino)-2-methylphenyl]-3,3-diisocyanoprop-2-enimidoyl isocyanide |
| SMILES | [C-]#[N+]C([N+]#[C-])=C(/C(=N/c1ccc(N(CC)CC)cc1C)[N+]#[C-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN5/c1-7-29(8-2)19-13-14-20(16(3)15-19)28-23(27-6)21(22(25-4)26-5)17-9-11-18(24)12-10-17/h9-15H,7-8H2,1-3H3/b28-23- |
| InChIKey | MACUFOZYSSWSTP-NFFVHWSESA-N |
| XLogP | 6.65 |
| TPSA | 28.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|