C12H20O2Si — CID 22138468
2-(2-bicyclo[2.2.1]hept-5-enyl)-2,4,5-trimethyl-1,3,2-dioxasilolane (PubChem CID 22138468) has the molecular formula C12H20O2Si and a molecular weight of 224.38 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-2,4,5-trimethyl-1,3,2-dioxasilolane.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-2,4,5-trimethyl-1,3,2-dioxasilolane |
|---|---|
| PubChem CID | 22138468 |
| Molecular Formula | C12H20O2Si |
| Molecular Weight | 224.38 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-2,4,5-trimethyl-1,3,2-dioxasilolane |
| SMILES | CC1O[Si](C)(C2CC3C=CC2C3)OC1C |
| InChI | InChI=1S/C12H20O2Si/c1-8-9(2)14-15(3,13-8)12-7-10-4-5-11(12)6-10/h4-5,8-12H,6-7H2,1-3H3 |
| InChIKey | JXGPPCSKOIOWEH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|