C13H22O2Si — CID 69438958
2-(2-bicyclo[2.2.1]hept-5-enyl)-2,4,5-trimethyl-1,3,2-dioxasilinane (PubChem CID 69438958) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-2,4,5-trimethyl-1,3,2-dioxasilinane.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-2,4,5-trimethyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 69438958 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-2,4,5-trimethyl-1,3,2-dioxasilinane |
| SMILES | CC1CO[Si](C)(C2CC3C=CC2C3)OC1C |
| InChI | InChI=1S/C13H22O2Si/c1-9-8-14-16(3,15-10(9)2)13-7-11-4-5-12(13)6-11/h4-5,9-13H,6-8H2,1-3H3 |
| InChIKey | QISQKVZLRSSLCM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|