C14H12N3O4- — CID 2217504
2-[(2,4-dimethyl-6-oxo-1-pyridinyl)iminomethyl]-4-nitrophenolate (PubChem CID 2217504) has the molecular formula C14H12N3O4- and a molecular weight of 286.27 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-6-oxo-1-pyridinyl)iminomethyl]-4-nitrophenolate.
| Compound Name | 2-[(2,4-dimethyl-6-oxo-1-pyridinyl)iminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 2217504 |
| Molecular Formula | C14H12N3O4- |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[(2,4-dimethyl-6-oxo-1-pyridinyl)iminomethyl]-4-nitrophenolate |
| SMILES | Cc1cc(C)n(N=Cc2cc([N+](=O)[O-])ccc2[O-])c(=O)c1 |
| InChI | InChI=1S/C14H13N3O4/c1-9-5-10(2)16(14(19)6-9)15-8-11-7-12(17(20)21)3-4-13(11)18/h3-8,18H,1-2H3/p-1 |
| InChIKey | RJDBDQICTXNHKP-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 100.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|