C14H11F6N3O2S — CID 22217312
ethyl N-[2-[(3-cyano-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate (PubChem CID 22217312) has the molecular formula C14H11F6N3O2S and a molecular weight of 399.32 g/mol. Its IUPAC name is ethyl N-[2-[(3-cyano-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate.
| Compound Name | ethyl N-[2-[(3-cyano-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22217312 |
| Molecular Formula | C14H11F6N3O2S |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | ethyl N-[2-[(3-cyano-4H-cyclopenta[b]thiophen-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(Nc1sc2c(c1C#N)CC=C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H11F6N3O2S/c1-2-25-11(24)23-12(13(15,16)17,14(18,19)20)22-10-8(6-21)7-4-3-5-9(7)26-10/h3,5,22H,2,4H2,1H3,(H,23,24) |
| InChIKey | XWUSVVTVIRBKME-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|