C10H11NO2S — CID 22269631
3,4-dihydro-1H-isothiochromen-6-ylcarbamic acid (PubChem CID 22269631) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 3,4-dihydro-1H-isothiochromen-6-ylcarbamic acid.
| Compound Name | 3,4-dihydro-1H-isothiochromen-6-ylcarbamic acid |
|---|---|
| PubChem CID | 22269631 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3,4-dihydro-1H-isothiochromen-6-ylcarbamic acid |
| SMILES | O=C(O)Nc1ccc2c(c1)CCSC2 |
| InChI | InChI=1S/C10H11NO2S/c12-10(13)11-9-2-1-8-6-14-4-3-7(8)5-9/h1-2,5,11H,3-4,6H2,(H,12,13) |
| InChIKey | IKUSAUXERZGSQS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |