C30H23ClF2N2O5S — CID 22275492
4-chloro-N-(2,5-difluorophenyl)-N-[3-(1,3-dioxoisoindol-2-yl)propoxy-phenylmethyl]benzenesulfonamide (PubChem CID 22275492) has the molecular formula C30H23ClF2N2O5S and a molecular weight of 597.04 g/mol. Its IUPAC name is 4-chloro-N-(2,5-difluorophenyl)-N-[3-(1,3-dioxoisoindol-2-yl)propoxy-phenylmethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(2,5-difluorophenyl)-N-[3-(1,3-dioxoisoindol-2-yl)propoxy-phenylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22275492 |
| Molecular Formula | C30H23ClF2N2O5S |
| Molecular Weight | 597.04 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 4-chloro-N-(2,5-difluorophenyl)-N-[3-(1,3-dioxoisoindol-2-yl)propoxy-phenylmethyl]benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCCOC(c1ccccc1)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H23ClF2N2O5S/c31-21-11-14-23(15-12-21)41(38,39)35(27-19-22(32)13-16-26(27)33)30(20-7-2-1-3-8-20)40-18-6-17-34-28(36)24-9-4-5-10-25(24)29(34)37/h1-5,7-16,19,30H,6,17-18H2 |
| InChIKey | HACHGGHULGDERP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.04 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|