C12H16BF4N3O3 — CID 22290193
2,6-dimethoxy-4-morpholin-4-ylbenzenediazonium tetrafluoroborate (PubChem CID 22290193) has the molecular formula C12H16BF4N3O3 and a molecular weight of 337.08 g/mol. Its IUPAC name is 2,6-dimethoxy-4-morpholin-4-ylbenzenediazonium tetrafluoroborate.
| Compound Name | 2,6-dimethoxy-4-morpholin-4-ylbenzenediazonium tetrafluoroborate |
|---|---|
| PubChem CID | 22290193 |
| Molecular Formula | C12H16BF4N3O3 |
| Molecular Weight | 337.08 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2,6-dimethoxy-4-morpholin-4-ylbenzenediazonium tetrafluoroborate |
| SMILES | COc1cc(N2CCOCC2)cc(OC)c1[N+]#N.F[B-](F)(F)F |
| InChI | InChI=1S/C12H16N3O3.BF4/c1-16-10-7-9(15-3-5-18-6-4-15)8-11(17-2)12(10)14-13;2-1(3,4)5/h7-8H,3-6H2,1-2H3;/q+1;-1 |
| InChIKey | NSDLPUKBSTWDBJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.08 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|