About CID 22294531
CID 22294531 (PubChem CID 22294531) has the molecular formula C12H25Cl2OSi
and a molecular weight of 284.32 g/mol.
Molecular Properties
| Compound Name | CID 22294531 |
| PubChem CID | 22294531 |
| Molecular Formula | C12H25Cl2OSi |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC(O[Si](C)C)C(Cl)Cl |
| InChI | InChI=1S/C12H25Cl2OSi/c1-4-5-6-7-8-9-10-11(12(13)14)15-16(2)3/h11-12H,4-10H2,1-3H3 |
| InChIKey | MRQOAGXTSQXVQS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22294531 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22294531?
The IUPAC name of CID 22294531 (CID 22294531) is not available.
What is the SMILES notation for CID 22294531?
The canonical SMILES for CID 22294531 is CCCCCCCCC(O[Si](C)C)C(Cl)Cl.
What is the InChIKey of CID 22294531?
The InChIKey is MRQOAGXTSQXVQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25Cl2OSi/c1-4-5-6-7-8-9-10-11(12(13)14)15-16(2)3/h11-12H,4-10H2,1-3H3.
What are the key properties of CID 22294531?
CID 22294531 has a molecular weight of 284.32 g/mol, XLogP of 5.18, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22294531 is sourced from PubChem (CID 22294531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).