C25H31NO2 — CID 22301970
[2-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-2-iminoethyl] 4-methylbenzoate (PubChem CID 22301970) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is [2-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-2-iminoethyl] 4-methylbenzoate.
| Compound Name | [2-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-2-iminoethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 22301970 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | [2-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-2-iminoethyl] 4-methylbenzoate |
| SMILES | [H]/N=C(\COC(=O)c1ccc(C)cc1)c1cc(C(C)(C)C)cc2c1CCC2(C)C |
| InChI | InChI=1S/C25H31NO2/c1-16-7-9-17(10-8-16)23(27)28-15-22(26)20-13-18(24(2,3)4)14-21-19(20)11-12-25(21,5)6/h7-10,13-14,26H,11-12,15H2,1-6H3/b26-22+ |
| InChIKey | OKNVOMZVGHNBDJ-XTCLZLMSSA-N |
| XLogP | 5.74 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|