About dichloromethane;N,N-diethylethanamine;ethanol
dichloromethane;N,N-diethylethanamine;ethanol (PubChem CID 22350034) has the molecular formula C9H23Cl2NO
and a molecular weight of 232.19 g/mol. Its IUPAC name is dichloromethane;N,N-diethylethanamine;ethanol.
Molecular Properties
| Compound Name | dichloromethane;N,N-diethylethanamine;ethanol |
| PubChem CID | 22350034 |
| Molecular Formula | C9H23Cl2NO |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | dichloromethane;N,N-diethylethanamine;ethanol |
| SMILES | CCN(CC)CC.CCO.ClCCl |
| InChI | InChI=1S/C6H15N.C2H6O.CH2Cl2/c1-4-7(5-2)6-3;1-2-3;2-1-3/h4-6H2,1-3H3;3H,2H2,1H3;1H2 |
| InChIKey | XHIKCWBOQBWVPU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;N,N-diethylethanamine;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;N,N-diethylethanamine;ethanol?
The IUPAC name of dichloromethane;N,N-diethylethanamine;ethanol (CID 22350034) is dichloromethane;N,N-diethylethanamine;ethanol.
What is the SMILES notation for dichloromethane;N,N-diethylethanamine;ethanol?
The canonical SMILES for dichloromethane;N,N-diethylethanamine;ethanol is CCN(CC)CC.CCO.ClCCl.
What is the InChIKey of dichloromethane;N,N-diethylethanamine;ethanol?
The InChIKey is XHIKCWBOQBWVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H6O.CH2Cl2/c1-4-7(5-2)6-3;1-2-3;2-1-3/h4-6H2,1-3H3;3H,2H2,1H3;1H2.
What are the key properties of dichloromethane;N,N-diethylethanamine;ethanol?
dichloromethane;N,N-diethylethanamine;ethanol has a molecular weight of 232.19 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;N,N-diethylethanamine;ethanol is sourced from PubChem (CID 22350034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).